| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | (+/-)-2-(tert-Butyloxycarbonyl)amino-3-(2-quinoxalyl)-propanic acid Basic information |
| Product Name: | (+/-)-2-(tert-Butyloxycarbonyl)amino-3-(2-quinoxalyl)-propanic acid | | Synonyms: | (+/-)-ALPHA-[[(1,1-DIMETHYLETHOXY)CARBONYL]-AMINO]-2-QUINOXALINYLPROPANIC ACID;BOC-3-(2-QUINOXALYL)-DL-ALANINE;BOC-3-(2-QUINOXALYL)-DL-ALA-OH;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-quinoxalin-2-ylpropanoic acid;Boc-3-(2-quinoxalyl)-DL-Ala-OH >=98.0% (HPLC);2-Quinoxalinepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-;Boc-3-(2-quinoxalyl)-DL-Ala-OH;(+/-)-2-(tert-Butyloxycarbonyl)amino-3-(2-quinoxalyl)-propanic acid | | CAS: | 833472-99-4 | | MF: | C16H19N3O4 | | MW: | 317.34 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | (+/-)-2-(tert-Butyloxycarbonyl)amino-3-(2-quinoxalyl)-propanic acid Chemical Properties |
| Melting point | 221-224 °C (decomp) | | Boiling point | 504.8±50.0 °C(Predicted) | | density | 1.273±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 3.56±0.10(Predicted) | | form | powder | | Major Application | peptide synthesis | | InChI | 1S/C16H19N3O4/c1-16(2,3)23-15(22)19-13(14(20)21)8-10-9-17-11-6-4-5-7-12(11)18-10/h4-7,9,13H,8H2,1-3H3,(H,19,22)(H,20,21) | | InChIKey | GOPADOFTCYAWLG-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NC(Cc1cnc2ccccc2n1)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (+/-)-2-(tert-Butyloxycarbonyl)amino-3-(2-quinoxalyl)-propanic acid Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | (+/-)-2-(tert-Butyloxycarbonyl)amino-3-(2-quinoxalyl)-propanic acid Preparation Products And Raw materials |
|