3-Furoyl chloride manufacturers
- 3-Furoyl chloride
-
- $0.00 / 1KG
-
2020-02-26
- CAS: 26214-65-3
- Min. Order: 1KG
- Purity: 99.0%+
- Supply Ability: 100 tons
|
| | 3-Furoyl chloride Basic information |
| Product Name: | 3-Furoyl chloride | | Synonyms: | 3-FUROYL CHLORIDE;Furan-3-carbonyl chloride, 3-(Chlorocarbonyl)furan;3-Furoyl chloride 97%;3-Furoyl chloride, GC 98%;3-Furancarbonyl chloride;3-Furoyl chloride ISO 9001:2015 REACH;SKL1198;3-Furoyl Chloride pure, 97% | | CAS: | 26214-65-3 | | MF: | C5H3ClO2 | | MW: | 130.53 | | EINECS: | | | Product Categories: | | | Mol File: | 26214-65-3.mol |  |
| | 3-Furoyl chloride Chemical Properties |
| Melting point | 25-30°C | | Boiling point | 62 °C | | density | 1.323±0.06 g/cm3(Predicted) | | refractive index | n20/D1.501 | | Fp | 58℃ | | storage temp. | 2-8°C, stored under nitrogen | | form | low melting solid | | color | White | | InChI | InChI=1S/C5H3ClO2/c6-5(7)4-1-2-8-3-4/h1-3H | | InChIKey | BTUIFMCWPFMNRG-UHFFFAOYSA-N | | SMILES | C(Cl)(C1C=COC=1)=O | | CAS DataBase Reference | 26214-65-3 |
| Hazard Codes | C | | Risk Statements | 34-36/37/38-29-14 | | Safety Statements | 26-36/37/39-45-30 | | RIDADR | 3261 | | WGK Germany | 1 | | Hazard Note | Corrosive | | HazardClass | IRRITANT | | HS Code | 2932190090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3-Furoyl chloride Usage And Synthesis |
| | 3-Furoyl chloride Preparation Products And Raw materials |
|