- 1,3,5-TRIETHYLBENZENE
-
- $15.00 / 1KG
-
2021-08-12
- CAS:102-25-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 1,3,5-TRIETHYLBENZENE
-
- $1.00 / 1KG
-
2019-09-02
- CAS:102-25-0
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 200kg
|
| | 1,3,5-TRIETHYLBENZENE Basic information |
| Product Name: | 1,3,5-TRIETHYLBENZENE | | Synonyms: | 1,3,5-TRIETHYLBENZENE;LABOTEST-BB LT00436984;1,3,5-triethyl-benzen;1,3,5-TRIETHYLBENZENE, 97+%;1,3,5-TRIETHYLBENZENE, TECH., 90%;Benzene, 1,3,5-triethyl-;1,3,5-trierhylbenzene;1,3,5 threeethylbenzene | | CAS: | 102-25-0 | | MF: | C12H18 | | MW: | 162.27 | | EINECS: | 203-017-3 | | Product Categories: | Arenes;Building Blocks;Organic Building Blocks;Building Blocks;Chemical Synthesis;Organic Building Blocks | | Mol File: | 102-25-0.mol |  |
| | 1,3,5-TRIETHYLBENZENE Chemical Properties |
| Melting point | -66 °C | | Boiling point | 215 °C (lit.) | | density | 0.862 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.495(lit.) | | Fp | 178 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Water Solubility | Insoluble in water. Soluble in alcohol, ether. | | BRN | 2039481 | | InChI | InChI=1S/C12H18/c1-4-10-7-11(5-2)9-12(6-3)8-10/h7-9H,4-6H2,1-3H3 | | InChIKey | WJYMPXJVHNDZHD-UHFFFAOYSA-N | | SMILES | C1(CC)=CC(CC)=CC(CC)=C1 | | CAS DataBase Reference | 102-25-0(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, 1,3,5-triethyl- (102-25-0) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2902.90.9000 | | HazardClass | 9 | | PackingGroup | III | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 4
Eye Irrit. 2
Skin Irrit. 2 |
| | 1,3,5-TRIETHYLBENZENE Usage And Synthesis |
| Uses | 1,3,5-Triethylbenzene was used as a supramoelcular template to organize molecular-recognition elements. It was also used to synthesize a series of di- and trinucleating ligands. | | Purification Methods | For separation from a commercial mixture see Dillingham and Reid [J Am Chem Soc 60 2606 1938]. [Beilstein 5 IV 133.] |
| | 1,3,5-TRIETHYLBENZENE Preparation Products And Raw materials |
|