| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Company Name: |
cjbscvictory |
| Tel: |
13348960310 13348960310 |
| Email: |
3003867561@qq.com |
|
| | CDK1/2InhibitorIII Basic information |
| Product Name: | CDK1/2InhibitorIII | | Synonyms: | CDK1/2InhibitorIII;5-amino-N-(2,6-difluorophenyl)-3-(4-sulfamoylanilino)-1,2,4-triazole-1-carbothioamide;2 Inhibitor III;Cdk-1/2 Inhibitor III,Cdk1/2 Inhibitor III;1H-1,2,4-Triazole-1-carbothioamide, 3-amino-5-[[4-(aminosulfonyl)phenyl]amino]-N-(2,6-difluorophenyl)- | | CAS: | 443798-55-8 | | MF: | C15H13F2N7O2S2 | | MW: | 425.44 | | EINECS: | | | Product Categories: | | | Mol File: | 443798-55-8.mol |  |
| | CDK1/2InhibitorIII Chemical Properties |
| Boiling point | 649.1±65.0 °C(Predicted) | | density | 1.72±0.1 g/cm3(Predicted) | | storage temp. | +2C to +8C | | solubility | DMSO: 10mg/mL
THF: soluble
acetone: soluble | | form | White solid | | pka | 6.61±0.70(Predicted) | | color | white | | InChI | 1S/C15H13F2N7O2S2/c16-10-2-1-3-11(17)12(10)21-15(27)24-13(18)22-14(23-24)20-8-4-6-9(7-5-8)28(19,25)26/h1-7H,(H,21,27)(H2,19,25,26)(H3,18,20,22,23) | | InChIKey | ARIOBGGRZJITQX-UHFFFAOYSA-N | | SMILES | Fc1c(c(ccc1)F)NC(=S)[n]2nc(nc2N)Nc3ccc(cc3)[S](=O)(=O)N |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | CDK1/2InhibitorIII Usage And Synthesis |
| Uses | Cyclin-dependent kinases (Cdks) are key regulators of cell cycle progression and are therefore promising targets for cancer therapy. Cdk1/2 Inhibitor III is a cell-permeable inhibitor of Cdk1/cyclin B and Cdk2/cyclin A (IC50s = 0.6 and 0.5 nM, respectively). It less potently inhibits CDC2-like kinases 1 and 3, VEGFR2, and GSK-3β (IC50s = 8.9, 29, 32, and 140 nM, respectively) and is without effect against a panel of other kinases. Cdk1/2 Inhibitor III blocks the growth of several cancer cell lines (IC50 values range from 20 to 92 nM). | | Uses | Cyclin-dependent kinases (CDKs) are protein kinases and involved with the regulation of the cell cycle. CDK 1/2 inhibitor III selectively inhibits CDK1 and CDK2. Studies have shown that CDK 1/2 Inhibitor III can also inhibit in vitro cellular proliferation in various human tumor cells. | | General Description | A cell-permeable triazolo-diamine compound that displays anti-proliferative properties in various human cancer cells (IC50 = 20 nM, 35 nM and 92 nM in HCT-116, HeLa, and A375 cells, respectively). Acts as a highly potent, reversible, ATP-competitive inhibitor of Cdk1/cyclin B and Cdk2/cyclin A (IC50 = 600 pM and 500 pM, respectively) with selectivity over VEGF-R2 (IC50 = 32 nM), GSK-3β (IC50 = 140 nM), and a panel of eight other kinases (IC50 ≥ 1 μM). | | Biochem/physiol Actions | Cell permeable: yes | | IC 50 | Cdk1/cyclin B: 2.1 μM (IC50) |
| | CDK1/2InhibitorIII Preparation Products And Raw materials |
|