- Mono Calcium Phosphate
-
- $1000.00/ ton
-
2025-12-30
- CAS:7758-23-8
- Min. Order: 1ton
- Purity: 22%
- Supply Ability: 1000 tons
|
| | Calcium phosphate monobasic Basic information |
| | Calcium phosphate monobasic Chemical Properties |
| Melting point | 109 °C | | Boiling point | 203 °C (decomposes) | | density | 2.22(16/4℃) | | refractive index | 1.5176 | | solubility | H2O: slightly soluble(lit.) | | form | Crystals | | Odor | Odorless | | Water Solubility | insoluble | | Merck | 13,1698 | | Stability: | Stable. Incompatible with strong acids. | | Cosmetics Ingredients Functions | VISCOSITY CONTROLLING BUFFERING ORAL CARE ABRASIVE ANTIPLAQUE BULKING | | Cosmetic Ingredient Review (CIR) | Calcium phosphate monobasic (7758-23-8) | | InChI | InChI=1S/Ca.2H3O4P/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/q+2;;/p-2 | | InChIKey | YYRMJZQKEFZXMX-UHFFFAOYSA-L | | SMILES | P(=O)(O)(O)[O-].P([O-])(=O)(O)O.[Ca+2] | | LogP | -2.148 (est) | | CAS DataBase Reference | 7758-23-8(CAS DataBase Reference) | | EPA Substance Registry System | Monocalcium phosphate (7758-23-8) |
| | Calcium phosphate monobasic Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Physical properties | Colorless shiny crystals, granules or powder; the impure material is hygro scopic due to the presence of trace phosphoric acid and other impurities; acid taste; density (monohydrate 2.22 g/cm3); monohydrate loses water at 100°C; decomposes at 200°C; moderately soluble in water; aqueous solution acidic; soluble in dilute mineral acids and acetic acid. | | Uses | Chiefly in fertilizers; as acidulant in baking powders and in wheat flours; mineral supplement for foods and feeds; in enameling. | | Preparation | Monobasic calcium phosphate may be prepared in the laboratory by the reaction of calcium carbonate with phosphoric acid:
CaCO3 + 2H3PO4 → Ca(H2PO4)2 + CO2 + H2O
| | Definition | ChEBI: Calcium bis(dihydrogenphosphate) is a calcium phosphate. It has a role as a fertilizer. | | Flammability and Explosibility | Non flammable |
| | Calcium phosphate monobasic Preparation Products And Raw materials |
|