- 1-Octylboronic acid
-
- $15.00 / 1KG
-
2021-08-12
- CAS:28741-08-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 1-Octylboronic acid
-
- $1.00 / 1KG
-
2019-07-06
- CAS:28741-08-4
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg;5kg;100kg
- 1-Octylboronic acid
-
- $1.00 / 1KG
-
2019-07-06
- CAS:28741-08-4
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg;5kg;100kg
|
| | 1-Octylboronic acid Basic information |
| Product Name: | 1-Octylboronic acid | | Synonyms: | RARECHEM AH PB 0170;N-OCTYLBORONIC ACID;OCTYLBORONIC ACID;Caprylboronic acid~n-Octaneboronic acid;N-Octylboronic;caprylboronic acid;n-octaneboronic acid;1-Octylboronic acid | | CAS: | 28741-08-4 | | MF: | C8H19BO2 | | MW: | 158.05 | | EINECS: | 681-714-5 | | Product Categories: | | | Mol File: | 28741-08-4.mol |  |
| | 1-Octylboronic acid Chemical Properties |
| Melting point | 78-81°C | | Boiling point | 262.6±23.0 °C(Predicted) | | density | 0.890±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | powder to crystal | | pka | 10.39±0.43(Predicted) | | color | White to Almost white | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | BRN | 1739759 | | InChI | InChI=1S/C8H19BO2/c1-3-4-5-6-7-8(2)9(10)11/h8,10-11H,3-7H2,1-2H3 | | InChIKey | GKFRVXOKPXCXAK-UHFFFAOYSA-N | | SMILES | CC(B(O)O)CCCCCC | | CAS DataBase Reference | 28741-08-4(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 1-Octylboronic acid Usage And Synthesis |
| Uses | 1-Octylboronic acid is used as an organic chemical synthesis intermediate. |
| | 1-Octylboronic acid Preparation Products And Raw materials |
|