|
|
| | 2-Methoxy-6-methylbenzoic acid Basic information |
| Product Name: | 2-Methoxy-6-methylbenzoic acid | | Synonyms: | 2-Methoxy-6-methylbenzoic acid;2-Methyl-6-methoxybenzoic acid;6-Methoxy-2-methylbenzoic acid;6-Methoxy-o-toluic acid;2-Methoxy-6-methylbenzoic acid ,97%;2-methoxy-6-methylbenzoic acid(SALTDATA: FREE);Benzoic acid, 2-Methoxy-6-Methyl-;2-Methoxy-6-methylbenzoic acid 98% | | CAS: | 6161-65-5 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | | | Product Categories: | | | Mol File: | 6161-65-5.mol |  |
| | 2-Methoxy-6-methylbenzoic acid Chemical Properties |
| Melting point | 137-138 °C | | Boiling point | 140 °C(Press: 18 Torr) | | density | 1.168±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.74±0.31(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C9H10O3/c1-6-4-3-5-7(12-2)8(6)9(10)11/h3-5H,1-2H3,(H,10,11) | | InChIKey | MICCJGFEXKNBLU-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(C)C=CC=C1OC | | CAS DataBase Reference | 6161-65-5 |
| WGK Germany | WGK 3 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-Methoxy-6-methylbenzoic acid Usage And Synthesis |
| | 2-Methoxy-6-methylbenzoic acid Preparation Products And Raw materials |
|