| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Metalaxyl (S)-enantiomer CAS:69516-34-3
|
| Company Name: |
CLEARSYNTH LABS LTD.
|
| Tel: |
+91-22-45045900 |
| Email: |
sales@clearsynth.com |
| Products Intro: |
Product Name:(S)-MetalaxylQ: What is
(S)-Metalaxyl Q: What is the CAS Number of
(S)-Metalaxyl CAS:69516-34-3
|
| Company Name: |
CHEMICAL LAND21
|
| Tel: |
82- 2 -783 - 8063 |
| Email: |
sales21@chemicalland21.com |
| Products Intro: |
|
|
| | L-Metalaxyl Basic information |
| Product Name: | L-Metalaxyl | | Synonyms: | L-Metalaxyl;(S)-Metalaxyl;N-(2-Methoxyacetyl)-N-(2,6-dimethylphenyl)-L-alanine methyl;N-(2-Methoxyacetyl)-N-(2,6-dimethylphenyl)-L-alanine methyl ester;(S)-MetalaxylQ: What is
(S)-Metalaxyl Q: What is the CAS Number of
(S)-Metalaxyl;Abscisic Acid Impurity 7-d3;Metalaxyl (S)-enantiomer | | CAS: | 69516-34-3 | | MF: | C15H21NO4 | | MW: | 279.33154 | | EINECS: | | | Product Categories: | | | Mol File: | 69516-34-3.mol |  |
| | L-Metalaxyl Chemical Properties |
| solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | InChI | 1S/C15H21NO4/c1-10-7-6-8-11(2)14(10)16(13(17)9-19-4)12(3)15(18)20-5/h6-8,12H,9H2,1-5H3/t12-/m0/s1 | | InChIKey | ZQEIXNIJLIKNTD-LBPRGKRZSA-N | | SMILES | N([C@@H](C)C(=O)OC)(c1c(cccc1C)C)C(=O)COC | | EPA Substance Registry System | L-(+)-Metalaxyl (69516-34-3) |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Skin Sens. 1 |
| | L-Metalaxyl Usage And Synthesis |
| Uses | (S)-Metalaxyl is the S-enantiomer of Metalaxyl (M258740(P)), an agricultural fungicide. Metalaxyl is a contaminant of emerging concern (CECs). It is useful in cannabis testing kits as a component of pesticide mixes (P698235(M)). | | Definition | ChEBI: (S)-metalaxyl is a methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate that is the less active S-enantiomer of metalaxyl. It is a methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate and a L-alanine derivative. It is an enantiomer of a metalaxyl-M. |
| | L-Metalaxyl Preparation Products And Raw materials |
|