|
|
| | N-Cbz-D-glutamic acid alpha-benzyl ester Basic information |
| | N-Cbz-D-glutamic acid alpha-benzyl ester Chemical Properties |
| Melting point | 98.0 to 102.0 °C | | Boiling point | 594.3±50.0 °C(Predicted) | | density | 1.268±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in methanol and acetic acid. | | pka | 4.47±0.10(Predicted) | | form | Powder | | color | White to off-white | | BRN | 5305848 | | Major Application | peptide synthesis | | InChI | 1S/C20H21NO6/c22-18(23)12-11-17(19(24)26-13-15-7-3-1-4-8-15)21-20(25)27-14-16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,21,25)(H,22,23)/t17-/m1/s1 | | InChIKey | VWHKODOUMSMUAF-QGZVFWFLSA-N | | SMILES | OC(=O)CC[C@@H](NC(=O)OCc1ccccc1)C(=O)OCc2ccccc2 | | CAS DataBase Reference | 65706-99-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids |
| | N-Cbz-D-glutamic acid alpha-benzyl ester Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | N-Cbz-D-glutamic acid alpha-benzyl ester is used as a reagent in the synthesis of acyl peptides that act as immunostimulants. | | Uses | This compound is used as a reagent in the synthesis of acyl peptides that act as immunostimulants. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Cbz-D-glutamic acid alpha-benzyl ester Preparation Products And Raw materials |
|