- 6-Isopropylpyridin-3-amine
-
- $0.00 / 1KG
-
2022-04-22
- CAS:405103-02-8
- Min. Order: 0.0001KG
- Purity: 98%min
- Supply Ability: 500kgs/month
|
| | 3-PYRIDINAMINE, 6-(1-METHYLETHYL)- Basic information |
| Product Name: | 3-PYRIDINAMINE, 6-(1-METHYLETHYL)- | | Synonyms: | 6-(1-Methylethyl)-3-Pyridinamine;3-Pyridinamine,6-(1-methylethyl)-(9CI);5-AMino-2-isopropylpyridine;6-lsopropylpyridin-3-aMine;3-PYRIDINAMINE, 6-(1-METHYLETHYL)-;3-Amino-6-isopropylpyridine;6-Isopropylpyridin-3-amine;6-(propan-2-yl)pyridin-3-aMine | | CAS: | 405103-02-8 | | MF: | C8H12N2 | | MW: | 136.19 | | EINECS: | | | Product Categories: | PYRIDINE;Pyridines | | Mol File: | 405103-02-8.mol |  |
| | 3-PYRIDINAMINE, 6-(1-METHYLETHYL)- Chemical Properties |
| Boiling point | 255.1±20.0 °C(Predicted) | | density | 1.008±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 6.77±0.10(Predicted) | | Appearance | Light yellow to brown Liquid | | InChI | InChI=1S/C8H12N2/c1-6(2)8-4-3-7(9)5-10-8/h3-6H,9H2,1-2H3 | | InChIKey | XYGFISRAXLLACA-UHFFFAOYSA-N | | SMILES | C1=NC(C(C)C)=CC=C1N |
| | 3-PYRIDINAMINE, 6-(1-METHYLETHYL)- Usage And Synthesis |
| Uses | 6-Isopropylpyridin-3-amine is used to prepare quinolinonecarboxamides as modulators of ATP-binding cassette transporters. | | Synthesis | General procedure for the synthesis of 3-amino-6-isopropylpyridine from 2-isopropyl-5-nitropyridine: 2-isopropyl-5-nitropyridine (1.30 g, 7.82 mmol) was dissolved in methanol (20 mL) and Raney Ni catalyst (0.25 g) was added. The reaction mixture was stirred for 2 hours at room temperature under hydrogen (1 atm) atmosphere. Upon completion of the reaction, the catalyst was removed by filtration and the filtrate was concentrated under reduced pressure to afford 2-isopropyl-5-aminopyridine (E-9) (0.55 g, 52% yield). The product was characterized by 1H NMR (CDCl3): δ 8.05 (s, 1H), 6.93-6.99 (m, 2H), 3.47 (br s, 2H), 2.92-3.02 (m, 1H), 1.24-1.26 (m, 6H).ESI-MS showed the molecular ion peak at 137.2 m/z (MH+). | | References | [1] Patent: US2011/98311, 2011, A1
[2] Patent: US2012/309758, 2012, A1
[3] Patent: US2015/231142, 2015, A1. Location in patent: Paragraph 0700 |
| | 3-PYRIDINAMINE, 6-(1-METHYLETHYL)- Preparation Products And Raw materials |
|