- 2-Nitrocinnamic acid
-
- $0.00 / 1KG
-
2026-03-20
- CAS:612-41-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
- 2-Nitrocinnamic acid
-
- $15.00 / 1KG
-
2021-08-12
- CAS:612-41-9
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 2-Nitrocinnamic acid
-
- $8.00 / 1kg
-
2019-07-06
- CAS:612-41-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10MT
|
| | 2-Nitrocinnamic acid Basic information |
| | 2-Nitrocinnamic acid Chemical Properties |
| Melting point | 243-245 °C(lit.) | | Boiling point | 329.36°C (rough estimate) | | density | 1.4058 (rough estimate) | | refractive index | 1.5200 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | pK1:4.15 (25°C) | | form | crystals | | Appearance | Light yellow to yellow Solid | | Water Solubility | insoluble | | BRN | 2211209 | | InChI | 1S/C9H7NO4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H,(H,11,12)/b6-5+ | | InChIKey | BBQDLDVSEDAYAA-AATRIKPKSA-N | | SMILES | OC(=O)\C=C\c1ccccc1[N+]([O-])=O | | CAS DataBase Reference | 612-41-9(CAS DataBase Reference) | | NIST Chemistry Reference | trans-2-Nitrocinnamic acid(612-41-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | UD3642850 | | HazardClass | IRRITANT | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids | | Toxicity | mouse,LD,intraperitoneal,> 350mg/kg (350mg/kg),BEHAVIORAL: CHANGES IN MOTOR ACTIVITY (SPECIFIC ASSAY)BEHAVIORAL: REGIDITYBEHAVIORAL: ATAXIA,Indian Journal of Pharmaceutical Sciences. Vol. 49, Pg. 77, 1987. |
| | 2-Nitrocinnamic acid Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder or needles |
| | 2-Nitrocinnamic acid Preparation Products And Raw materials |
|