|
|
| | 2-Methylpropanethioamide Basic information |
| | 2-Methylpropanethioamide Chemical Properties |
| Melting point | 45-48℃ | | Boiling point | 203-205 °C(Press: 30 Torr) | | density | 0.995±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | solubility | Chloroform | | form | Solid | | pka | 13.19±0.29(Predicted) | | color | White Crystalline | | InChI | InChI=1S/C4H9NS/c1-3(2)4(5)6/h3H,1-2H3,(H2,5,6) | | InChIKey | NPCLRBQYESMUPD-UHFFFAOYSA-N | | SMILES | C(N)(=S)C(C)C | | CAS DataBase Reference | 13515-65-6 |
| | 2-Methylpropanethioamide Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | 2-Methylpropanethioamide is a useful synthetic intermediate. |
| | 2-Methylpropanethioamide Preparation Products And Raw materials |
|