Deoxy Artemisinin manufacturers
- Deoxyartemisinin
-
- $60.00 / 1mg
-
2026-01-30
- CAS:72826-63-2
- Min. Order:
- Purity: 97.35%
- Supply Ability: 10g
|
| | Deoxy Artemisinin Basic information |
| Product Name: | Deoxy Artemisinin | | Synonyms: | (3R,3aS,6R,6aS,9S,10aS,10bR)-Octahydro-3,6,9-trimethyl-10aH-9,10b-epoxypyrano[4,3,2-jk][2]benzoxepin-2(3H)-one;Deoxy Artemisinin;Deoxyarteannuin;Deoxyartemisinin;Deoxyqinghaosu;Desoxyartemisinin;Hydroarteannuin;Qing Hau Sau II | | CAS: | 72826-63-2 | | MF: | C15H22O4 | | MW: | 266.33 | | EINECS: | | | Product Categories: | Drug Analogues;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 72826-63-2.mol |  |
| | Deoxy Artemisinin Chemical Properties |
| Melting point | 104-106°C | | Boiling point | 387.9±37.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C15H22O4/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-15/h8-11,13H,4-7H2,1-3H3/t8-,9-,10+,11+,13-,14-,15-/m1/s1 | | InChIKey | ZQGMLVQZBIKKMP-NNWCWBAJSA-N | | SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23O4 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Deoxy Artemisinin Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | An analogue of Artemisinin, an antimalarial agent. | | target | Antifection |
| | Deoxy Artemisinin Preparation Products And Raw materials |
| Raw materials | Cyclohexaneacetaldehyde, α,4-dimethyl-2-oxo-3-(3-oxobutyl)-, (αR,1S,3S,4R)--->Cyclohexaneacetaldehyde, α,4-dimethyl-2-oxo-3-(3-oxobutyl)-, (αR,1R,3S,4R)--->DHQHS 2-->L-Cysteine | | Preparation Products | anhydrodihydroartemisinin-->Artemisinin |
|