| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-Methylpyrrolidin-3-one Basic information |
| | 1-Methylpyrrolidin-3-one Chemical Properties |
| Boiling point | 185.62°C (rough estimate) | | density | 0.984 g/mL at 25 °C | | refractive index | n20/D1.451 | | Fp | 42°(108°F) | | storage temp. | -20°C | | pka | 6.51±0.20(Predicted) | | InChI | InChI=1S/C5H9NO/c1-6-3-2-5(7)4-6/h2-4H2,1H3 | | InChIKey | SLPUTJFVMJPMKV-UHFFFAOYSA-N | | SMILES | N1(C)CCC(=O)C1 | | CAS DataBase Reference | 68165-06-0 | | NIST Chemistry Reference | 3-Pyrrolidone, 1-methyl-(68165-06-0) |
| Hazard Codes | Xi | | Risk Statements | 10-37/38-41-43 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 1993C 3 / PGIII | | WGK Germany | 2 | | HazardClass | 3 | | HS Code | 2933998090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 1-Methylpyrrolidin-3-one Usage And Synthesis |
| | 1-Methylpyrrolidin-3-one Preparation Products And Raw materials |
|