- Haloxyfop
-
- $40.00
-
2026-05-11
- CAS:69806-34-4
- Purity: 99.96%
- Supply Ability: 10g
|
| | 2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid Basic information |
| | 2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid Chemical Properties |
| Melting point | 107.5 °C | | Boiling point | 420.3±45.0 °C(Predicted) | | density | 1.442±0.06 g/cm3(Predicted) | | storage temp. | 0-6°C | | solubility | DMSO : 100 mg/mL (276.47 mM; Need ultrasonic) | | pka | 3.12±0.10(Predicted) | | form | Solid | | color | White to off-white | | BRN | 1507817 | | Major Application | agriculture
environmental | | InChI | 1S/C15H11ClF3NO4/c1-8(14(21)22)23-10-2-4-11(5-3-10)24-13-12(16)6-9(7-20-13)15(17,18)19/h2-8H,1H3,(H,21,22) | | InChIKey | GOCUAJYOYBLQRH-UHFFFAOYSA-N | | SMILES | CC(Oc1ccc(Oc2ncc(cc2Cl)C(F)(F)F)cc1)C(O)=O | | CAS DataBase Reference | 69806-34-4(CAS DataBase Reference) | | EPA Substance Registry System | Haloxyfop (69806-34-4) |
| WGK Germany | 3 | | RTECS | UA2458284 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Eye Dam. 1 |
| | 2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid Usage And Synthesis |
| Uses | (±)-Haloxyfop is a herbicide. | | Definition | ChEBI: 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid is a monocarboxylic acid that is 2-phenoxypropanoic acid in which the hydrogen at the para position of the phenyl ring has been replaced by a [3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy group. It is a member of pyridines, an aromatic ether, a monocarboxylic acid, an organofluorine compound and an organochlorine compound. |
| | 2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid Preparation Products And Raw materials |
|