- PI379
-
- $0.00 / 1KG
-
2026-01-30
- CAS:119344-86-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- Irgacure 379
-
- $0.00 / 25KG
-
2025-06-27
- CAS:119344-86-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| Product Name: | PI379 | | Synonyms: | 1-Butanone, 2-(dimethylamino)-2-(4-methylphenyl)methyl-1-4-(4-morpholinyl)phenyl-;2-(Dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(4 -morpholinyl)phenyl]-1-butanone;2-(4-Methylbenzyl)-2-(dimethylamino)-1-(4-morpholinophenyl)butan-1-one;Irgacure 379;Keycure 8179;2-Dimethylamino-2-(4-methyl-benzyl)-1-(4-morpholin-4-yl-phenyl)-butan-1-one;former IRGACURE 379;IHT-PI 379 | | CAS: | 119344-86-4 | | MF: | C24H32N2O2 | | MW: | 380.52 | | EINECS: | 438-340-0 | | Product Categories: | | | Mol File: | 119344-86-4.mol |  |
| | PI379 Chemical Properties |
| Boiling point | 542.0±50.0 °C(Predicted) | | density | 1.083 | | vapor pressure | 0Pa at 25℃ | | storage temp. | 2-8°C, protect from light | | solubility | 2.75 in mg/100g standard fat at 20 ℃ | | pka | 6.74±0.50(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | 1.9mg/L at 20℃ | | InChI | InChI=1S/C24H32N2O2/c1-5-24(25(3)4,18-20-8-6-19(2)7-9-20)23(27)21-10-12-22(13-11-21)26-14-16-28-17-15-26/h6-13H,5,14-18H2,1-4H3 | | InChIKey | PUBNJSZGANKUGX-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(N2CCOCC2)C=C1)(=O)C(N(C)C)(CC1=CC=C(C)C=C1)CC | | LogP | 4.1 at 25℃ | | CAS DataBase Reference | 119344-86-4 | | EPA Substance Registry System | 1-Butanone, 2-(dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(4-morpholinyl)phenyl]- (119344-86-4) |
| | PI379 Usage And Synthesis |
| Chemical Properties | Light yellow solid | | Uses | PI379 (Photoinitiator379) is a highly efficient ultraviolet (UV) initiator, mainly used in UV curing systems such as inks and coatings. | | Flammability and Explosibility | Non flammable |
| | PI379 Preparation Products And Raw materials |
|