|
|
| | Phenol, 2,4-dibromo-6-(4-hydroxycyclohexyl)aminomethyl-, hydrochloride, trans- Basic information |
| Product Name: | Phenol, 2,4-dibromo-6-(4-hydroxycyclohexyl)aminomethyl-, hydrochloride, trans- | | Synonyms: | Phenol, 2,4-dibromo-6-(4-hydroxycyclohexyl)aminomethyl-, hydrochloride, trans-;Dembrexine hydrochloride monohydrate CRS;Dembrexine HCl Monohydrate;2,4-dibromo-6-((((1r,4r)-4-hydroxycyclohexyl)amino)methyl)phenol hydrochloride hydrate;Dembrexine Hydrochloride;2,4-dibromo-6-[[(4-hydroxycyclohexyl)amino]methyl]phenol,hydrochloride;Dembrexine HCl;Dembrexine hydrochloride monohydrate in methanol | | CAS: | 52702-51-9 | | MF: | C13H17Br2NO2.ClH | | MW: | 415.55 | | EINECS: | | | Product Categories: | | | Mol File: | 52702-51-9.mol |  |
| | Phenol, 2,4-dibromo-6-(4-hydroxycyclohexyl)aminomethyl-, hydrochloride, trans- Chemical Properties |
| storage temp. | 2-8°C | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C13H17Br2NO2.ClH/c14-9-5-8(13(18)12(15)6-9)7-16-10-1-3-11(17)4-2-10;/h5-6,10-11,16-18H,1-4,7H2;1H/t10-,11-; | | InChIKey | BGRWLVRJIPTKQW-PFWPSKEQSA-N | | SMILES | Brc1c(c(cc(c1)Br)CN[C@@H]2CC[C@H](CC2)O)O.Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Phenol, 2,4-dibromo-6-(4-hydroxycyclohexyl)aminomethyl-, hydrochloride, trans- Usage And Synthesis |
| Uses | Dembrexine Hydrochloride is a benzylamine derivative which increase the absorption of parenteral antibiotics. |
| | Phenol, 2,4-dibromo-6-(4-hydroxycyclohexyl)aminomethyl-, hydrochloride, trans- Preparation Products And Raw materials |
|