|
|
| | 3-Chloro-4-piperidin-1-yl-phenylamine Basic information |
| Product Name: | 3-Chloro-4-piperidin-1-yl-phenylamine | | Synonyms: | LABOTEST-BB LT01277325;ASISCHEM A93469;ART-CHEM-BB B021987;AKOS BB-8564;AKOS B021987;ZERENEX E/4047671;TIMTEC-BB SBB007137;Benzenamine, 3-chloro-4-(1-piperidinyl)- | | CAS: | 55403-26-4 | | MF: | C11H15ClN2 | | MW: | 210.7 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 3-Chloro-4-piperidin-1-yl-phenylamine Chemical Properties |
| Boiling point | 376.4±32.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 6.72±0.10(Predicted) | | InChI | 1S/C11H15ClN2/c12-10-8-9(13)4-5-11(10)14-6-2-1-3-7-14/h4-5,8H,1-3,6-7,13H2 | | InChIKey | NIGYLYWAEONQRX-UHFFFAOYSA-N | | SMILES | NC1=CC=C(C(Cl)=C1)N2CCCCC2 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Chloro-4-piperidin-1-yl-phenylamine Usage And Synthesis |
| | 3-Chloro-4-piperidin-1-yl-phenylamine Preparation Products And Raw materials |
|