|
|
| | Starch, hydrogen phosphate acetate Basic information |
| Product Name: | Starch, hydrogen phosphate acetate | | Synonyms: | Starch, hydrogen phosphate acetate;starch, acetate hydrogen phosphate;Acetylated distarch pllosphate;Starch, hydrogen phosphate acetate USP/BP/EP;DISTARCH PHOSPHATE ACETATE;Acetylated distarc | | CAS: | 68130-14-3 | | MF: | C2H4O2.x(H3PO4).x(C6H10O5) | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![Starch, hydrogen phosphate acetate Structure]() |
| | Starch, hydrogen phosphate acetate Chemical Properties |
| | Starch, hydrogen phosphate acetate Usage And Synthesis |
| Chemical Properties | White powder. The viscosity is stable at high temperature and low pH value, the degree of retrogradation of paste liquid during freezing process is low, and the freezing resistance stability is high. Solubility, swelling power and transparency were significantly improved compared to native starch. | | Uses | Acetylated distarch phosphate can improve water retention, increase meat tenderness and improve taste, and is not affected by high and low temperature. | | Synthesis | Acetylated distarch phosphate is formed by esterification of sodium trimetaphosphate or phosphorus oxychloride with acetic anhydride (≤10%) or vinyl acetate (≤7.5%) and starch. |
| | Starch, hydrogen phosphate acetate Preparation Products And Raw materials |
|