|
|
| | Boc-D-Phe(2,4-DiCl)-OH Basic information |
| Product Name: | Boc-D-Phe(2,4-DiCl)-OH | | Synonyms: | (R)-2-TERT-BUTOXYCARBONYLAMINO-3-(2,4-DICHLORO-PHENYL)-PROPIONIC ACID;N-TERT-BUTOXYCARBONYL-2,4-DICHLORO-D-PHENYLALANINE;N-ALPHA-T-BUTOXYCARBONYL-D-(2,4-DICHLOROPHENYL)ALANINE;RARECHEM BK PT 0113;(R)-BOC-2,4-DICHLOROPHENYLALANINE;BOC-D-PHE(2,4-CL2)-OH;BOC-D-PHE(2,4-DICL)-OH;BOC-2,4-DICHLORO-D-PHENYLALANINE | | CAS: | 114873-12-0 | | MF: | C14H17Cl2NO4 | | MW: | 334.2 | | EINECS: | | | Product Categories: | Amino Acid Derivatives | | Mol File: | 114873-12-0.mol |  |
| | Boc-D-Phe(2,4-DiCl)-OH Chemical Properties |
| Melting point | 133-137 °C | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +32.5±1°, c = 1% in methanol | | Major Application | peptide synthesis | | InChI | 1S/C14H17Cl2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)6-8-4-5-9(15)7-10(8)16/h4-5,7,11H,6H2,1-3H3,(H,17,20)(H,18,19)/t11-/m1/s1 | | InChIKey | KSDWBXFRQWMWHO-LLVKDONJSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc(Cl)cc1Cl)C(O)=O | | CAS DataBase Reference | 114873-12-0 |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29223900 | | Storage Class | 11 - Combustible Solids |
| | Boc-D-Phe(2,4-DiCl)-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-D-Phe(2,4-DiCl)-OH Preparation Products And Raw materials |
|