Ethyl 7-chloro-4-hydroxy-8-methylquinoline-3-carboxylate manufacturers
|
| | Ethyl 7-chloro-4-hydroxy-8-methylquinoline-3-carboxylate Basic information |
| Product Name: | Ethyl 7-chloro-4-hydroxy-8-methylquinoline-3-carboxylate | | Synonyms: | 7-chloro-4-keto-8-methyl-1H-quinoline-3-carboxylic acid ethyl ester;ethyl 7-chloro-8-methyl-4-oxo-1H-quinoline-3-carboxylate;7-chloro-2-ethyl-8-methyl-4-oxo-1H-quinoline-3-carboxylate;3-Quinolinecarboxylic acid, 7-chloro-4-hydroxy-8-methyl-, ethyl ester;Ethyl 7-chloro-4-hydroxy-8-methylquinoline-3-carboxylate ISO 9001:2015 REACH | | CAS: | 5350-94-7 | | MF: | C13H12ClNO3 | | MW: | 265.69 | | EINECS: | | | Product Categories: | blocks;Carboxes;Quinolines | | Mol File: | 5350-94-7.mol |  |
| | Ethyl 7-chloro-4-hydroxy-8-methylquinoline-3-carboxylate Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C13H12ClNO3/c1-3-18-13(17)9-6-15-11-7(2)10(14)5-4-8(11)12(9)16/h4-6H,3H2,1-2H3,(H,15,16) | | InChIKey | HOKMOQAMIGSWSJ-UHFFFAOYSA-N | | SMILES | O=C1C(C(OCC)=O)=CNC2=C(C)C(Cl)=CC=C12 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Ethyl 7-chloro-4-hydroxy-8-methylquinoline-3-carboxylate Usage And Synthesis |
| | Ethyl 7-chloro-4-hydroxy-8-methylquinoline-3-carboxylate Preparation Products And Raw materials |
|