2'',3'',5''-TRIFLUOROACETOPHENONE manufacturers
|
| | 2'',3'',5''-TRIFLUOROACETOPHENONE Basic information |
| Product Name: | 2'',3'',5''-TRIFLUOROACETOPHENONE | | Synonyms: | 2,3,5-Trifluoroacetophenone;2',3',5'-Trifluoroacetophenone;1-(2,3,5-Trifluorophenyl)ethan-1-one;1-(2,3,5-Trifluorophenyl)ethanone;Ethanone, 1-(2,3,5-trifluorophenyl)-;2',3',5'-TrifluoroacetophenoneOPHENONE;2'',3'',5''-TRIFLUOROACETOPHENONE;2′,3′,5′-Trifluoroacetophenone, CAS 243459-93-0 | | CAS: | 243459-93-0 | | MF: | C8H5F3O | | MW: | 174.12 | | EINECS: | | | Product Categories: | Fluorine series | | Mol File: | 243459-93-0.mol |  |
| | 2'',3'',5''-TRIFLUOROACETOPHENONE Chemical Properties |
| Boiling point | 193.3±35.0 °C(Predicted) | | density | 1.303±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C8H5F3O/c1-4(12)6-2-5(9)3-7(10)8(6)11/h2-3H,1H3 | | InChIKey | ZCVPTIVXINDYGY-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(F)=CC(F)=C1F)C | | CAS DataBase Reference | 243459-93-0 |
| | 2'',3'',5''-TRIFLUOROACETOPHENONE Usage And Synthesis |
| | 2'',3'',5''-TRIFLUOROACETOPHENONE Preparation Products And Raw materials |
|