| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Piperidinecarboxylic acid t-butyl ester HCl Basic information |
| Product Name: | 4-Piperidinecarboxylic acid t-butyl ester HCl | | Synonyms: | tert-Butyl piperidine-4-carboxylate hydrochloride;4-Piperidine carboxylic acid t-butyl esterhydrochloride;4-Piperidinecarboxylic acid tert-butyl ester HCl;tert-Butyl piperidine-4-Carboxylate HCl;4-Piperidinecarboxylicacid, 1,1-dimethylethyl ester, hydrochloride;Piperidine-4-carboxylic acid tert-butyl ester hydrochloride;-4- piperidineforMic acidtert butyl ester hydrochloride;Pyrrolidine-4-carboxylic acid tert-butyl ester HCl salt | | CAS: | 892493-65-1 | | MF: | C10H19NO2.ClH | | MW: | 221.72 | | EINECS: | | | Product Categories: | | | Mol File: | 892493-65-1.mol |  |
| | 4-Piperidinecarboxylic acid t-butyl ester HCl Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H19NO2.ClH/c1-10(2,3)13-9(12)8-4-6-11-7-5-8;/h8,11H,4-7H2,1-3H3;1H | | InChIKey | VLFRGIAACOBTLR-UHFFFAOYSA-N | | SMILES | C(C1CCNCC1)(=O)OC(C)(C)C.Cl |
| | 4-Piperidinecarboxylic acid t-butyl ester HCl Usage And Synthesis |
| Chemical Properties | White to light yellow crystalline powder |
| | 4-Piperidinecarboxylic acid t-butyl ester HCl Preparation Products And Raw materials |
|