| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-(2H-Tetrazol-5-yl)-phenylboronic acid Basic information |
| | 2-(2H-Tetrazol-5-yl)-phenylboronic acid Chemical Properties |
| Melting point | 148-152°C | | Boiling point | 507.1±60.0 °C(Predicted) | | density | 1.51 | | storage temp. | 2-8°C | | pka | 4.35±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H7BN4O2/c13-8(14)6-4-2-1-3-5(6)7-9-11-12-10-7/h1-4,13-14H,(H,9,10,11,12) | | InChIKey | GVRXWYFECKHTSJ-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC=C1C1=NNN=N1)(O)O |
| Hazard Codes | Xi,Xn | | Risk Statements | 36-22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2-(2H-Tetrazol-5-yl)-phenylboronic acid Usage And Synthesis |
| Uses | 2-(Tetrazol-5-yl)phenylboronic Acid acts as a reagent in the synthesis of (biphenylmethyl)pyridone and (pyridylmethyl)pyridone pharmaceuticals for the treatment of glaucoma and diabetic retinopathy. Also acts as a reagent for the preparation of sartan drug intermediates. Sartans are agiotensin receptor blockers. | | Reactions |
Thermal decomposition of 2-(2H-Tetrazol-5-yl)-phenylboronic acid can lead to release of irritating gases and vapors, Carbon monoxide (CO), Carbon dioxide (CO2), Oxides of boron, Nitrogen oxides (NOx)
|
| | 2-(2H-Tetrazol-5-yl)-phenylboronic acid Preparation Products And Raw materials |
|