|
|
| | 2-Pyridinecarboxamide,4-amino-(9CI) Basic information |
| | 2-Pyridinecarboxamide,4-amino-(9CI) Chemical Properties |
| Melting point | 169 °C | | Boiling point | 413.0±30.0 °C(Predicted) | | density | 1.323±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 15.33±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H7N3O/c7-4-1-2-9-5(3-4)6(8)10/h1-3H,(H2,7,9)(H2,8,10) | | InChIKey | QKNCZYUYGMWQPB-UHFFFAOYSA-N | | SMILES | C1(C(N)=O)=NC=CC(N)=C1 |
| | 2-Pyridinecarboxamide,4-amino-(9CI) Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 4-aminopyridinamide (99B) from 4-nitro-2-pyridine carboxamide (99A): 99A (40 mg) was dissolved in methanol, 10% Pd/C catalyst (40 mg) was added, and the hydrogenation reaction was carried out for 8 hours under the atmosphere of a hydrogen balloon. Upon completion of the reaction, the Pd/C catalyst was removed by filtration. The filtrate was concentrated to give a white solid 99B (80 mg, 87% yield). The product was characterized by 1H NMR (400 MHz, methanol-d4): δ 6.65 (dd, J = 5.71, 2.64 Hz, 1H), 7.27 (d, J = 2.20 Hz, 1H), 8.03 (d, J = 5.71 Hz, 1H). | | References | [1] Patent: US2010/227894, 2010, A1. Location in patent: Page/Page column 76-77 |
| | 2-Pyridinecarboxamide,4-amino-(9CI) Preparation Products And Raw materials |
|