- 5-Chloroisatin
-
- $0.00 / 25kg
-
2025-08-27
- CAS:17630-76-1
- Min. Order: 1kg
- Purity: 98.0%min
- Supply Ability: 10tons
|
| | 5-Chloroisatin Basic information |
| Product Name: | 5-Chloroisatin | | Synonyms: | 5-Chloroisatin,95%;5-Chloroindolin-2,3-dione;5-Chloroisatin ,98%;Indole-2,3-dione, 5-chloro- (7CI,8CI);Isatin, 5-chloro- (6CI);NSC 135811;5-Chloroindolin-2,3-dione, 5-Chloro-1H-indole-2,3-dione;TIMTEC-BB SBB003741 | | CAS: | 17630-76-1 | | MF: | C8H4ClNO2 | | MW: | 181.58 | | EINECS: | 241-614-0 | | Product Categories: | Indane/Indanone and Derivatives | | Mol File: | 17630-76-1.mol |  |
| | 5-Chloroisatin Chemical Properties |
| Melting point | 254-258 °C (lit.) | | density | 1.3743 (rough estimate) | | refractive index | 1.5560 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | 8.65±0.20(Predicted) | | Appearance | Yellow to orange Solid | | Water Solubility | insoluble | | BRN | 383759 | | InChI | InChI=1S/C8H4ClNO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) | | InChIKey | XHDJYQWGFIBCEP-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Cl)C=C2)C(=O)C1=O | | CAS DataBase Reference | 17630-76-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Chloroisatin Usage And Synthesis |
| Chemical Properties | pale yellow to reddish or yellow-brownish powder | | Uses | 5-Chloroisatin is a reagent used in the synthesis of Schiff bases through the reaction with 2-methyl-4-nitroaniline or 4-amino-4,5-dihydro-1H-1,2,3-triazole-5-one. | | Definition | ChEBI: 5-Chloro-1H-indole-2,3-dione is a member of indoles. It has a role as an anticoronaviral agent. | | General Description | 5-Chloroisatin reacts with substituted 4-amino-4,5-dihydro-1H-1,2,4-triazole-5-ones to yield Schiff bases. |
| | 5-Chloroisatin Preparation Products And Raw materials |
|