|
|
| | 1-BROMO-2,4,6-TRIISOPROPYLBENZENE Basic information |
| Product Name: | 1-BROMO-2,4,6-TRIISOPROPYLBENZENE | | Synonyms: | 1-Bromo-2,4,6-triisopropylbenzene~2,4,6-Triisopropylbromobenzene;1-Bromo-2,4,6-triisopropylbenzene, 98+%;2,4,6-Triisopropylbromobenzene;2,4,6-Triisopropylbromobenzene, 2-Bromo-1,3,5-triisopropylbenzene;1,3,5-Triisopropyl-2-bromobenzene;2,4,6-Triisopropylphenyl bromide;1-BroMo-2,4,6-tri-i-propylbenzene;2-broMo-1,3,5-tris(propan-2-yl)benzene | | CAS: | 21524-34-5 | | MF: | C15H23Br | | MW: | 283.25 | | EINECS: | 1312995-182-4 | | Product Categories: | Indolines ,Indoles ,Indazoles | | Mol File: | 21524-34-5.mol |  |
| | 1-BROMO-2,4,6-TRIISOPROPYLBENZENE Chemical Properties |
| Boiling point | 96-97 °C0.1 mm Hg(lit.) | | density | 1.118 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.523(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | Slightly miscible with water. | | BRN | 1953440 | | InChI | InChI=1S/C15H23Br/c1-9(2)12-7-13(10(3)4)15(16)14(8-12)11(5)6/h7-11H,1-6H3 | | InChIKey | FUMMYHVKFAHQST-UHFFFAOYSA-N | | SMILES | C1(C(C)C)=CC(C(C)C)=CC(C(C)C)=C1Br | | CAS DataBase Reference | 21524-34-5 |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | HS Code | 29039990 | | Storage Class | 10 - Combustible liquids |
| | 1-BROMO-2,4,6-TRIISOPROPYLBENZENE Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | suzuki reaction | | Uses | 1-Bromo-2,4,6-triisopropylbenzene can be used in the synthesis of 1-fluoro-2,4,6-triisopropylbenzene, a fluorine-substituted aromatic building block for agrochemical synthesis and pharmaceutical production. It can also be used in the synthesis of di-2,4,6-triisopropylphenyl diselenide via reaction with metallic selenium in the presence of tertiary-butyl lithium. | | Synthesis Reference(s) | Synthesis, p. 621, 1976 DOI: 10.1055/s-1976-24146 |
| | 1-BROMO-2,4,6-TRIISOPROPYLBENZENE Preparation Products And Raw materials |
|