|
|
| | acetoacetaldehyde Basic information |
| Product Name: | acetoacetaldehyde | | Synonyms: | acetoacetaldehyde;Butanal, 3-oxo-;3-ketobutyraldehyde;3-oxobutanal;Fenelunitinib impurity SM1Z4 | | CAS: | 625-34-3 | | MF: | C4H6O2 | | MW: | 86.09 | | EINECS: | | | Product Categories: | | | Mol File: | 625-34-3.mol |  |
| | acetoacetaldehyde Chemical Properties |
| Boiling point | 30 °C(Press: 24 Torr) | | density | 1.097 g/cm3 | | pka | 5.92±0.23(Predicted) | | InChI | InChI=1S/C4H6O2/c1-4(6)2-3-5/h3H,2H2,1H3 | | InChIKey | PKQIDSVLSKFZQC-UHFFFAOYSA-N | | SMILES | C(=O)CC(=O)C |
| | acetoacetaldehyde Usage And Synthesis |
| | acetoacetaldehyde Preparation Products And Raw materials |
|