|
|
| | (S)-4-Bromo-alpha-methylbenzyl alcohol Basic information |
| | (S)-4-Bromo-alpha-methylbenzyl alcohol Chemical Properties |
| Boiling point | 116 °C(Press: 5.2 Torr) | | density | 1.322 g/mL at 25 °C | | refractive index | n20/D 1.570 | | Fp | 110 °C | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | pka | 14.22±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | [α]20/D -38.0°, c = 1 in chloroform | | InChI | InChI=1/C8H9BrO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3/t6-/s3 | | InChIKey | XTDTYSBVMBQIBT-LURJTMIESA-N | | SMILES | C1([C@H](C)O)=CC=C(C=C1)Br |&1:1,r| | | CAS DataBase Reference | 100760-04-1 |
| Provider | Language |
|
ACROS
| English |
| | (S)-4-Bromo-alpha-methylbenzyl alcohol Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | (S)-1-(4-Bromophenyl)ethanol is a building block used in organic synthesis of photochemically active and photophysical pthalocyanines. | | Purification Methods | The (±)-racemate is purified by distillation in a vacuum (b 90o/1mm, 119-121o/7mm, d 1.46) and it solidifies on cooling (m 36-37o) [Overberger et al. Org Synth |
| | (S)-4-Bromo-alpha-methylbenzyl alcohol Preparation Products And Raw materials |
|