phenazine-1-carboxamide manufacturers
- Oxychlororaphine
-
- $34.00 / 2mg
-
2025-05-14
- CAS:550-89-0
- Min. Order:
- Purity: 97.4%
- Supply Ability: 10g
|
| | phenazine-1-carboxamide Basic information |
| Product Name: | phenazine-1-carboxamide | | Synonyms: | phenazine-1-carboxamide;1-Phenazinecarboxamide;Oxychloraphin, Phenazine-1-carboxyaMide, Xanthoraphine;Oxychloroaphine;Oxychloraphine;Oxychlororaphine;1-Phenazinecarboxamide (6CI, 7CI, 8CI, 9CI, ACI);Oxychlororaphine, 10 mM in DMSO | | CAS: | 550-89-0 | | MF: | C13H9N3O | | MW: | 223.23 | | EINECS: | | | Product Categories: | | | Mol File: | 550-89-0.mol |  |
| | phenazine-1-carboxamide Chemical Properties |
| Melting point | 241 °C | | Boiling point | 526.1±15.0 °C(Predicted) | | density | 1.371±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Heated) | | form | A crystalline solid | | pka | 14.33±0.30(Predicted) | | color | Light yellow to brown | | InChI | InChI=1S/C13H9N3O/c14-13(17)8-4-3-7-11-12(8)16-10-6-2-1-5-9(10)15-11/h1-7H,(H2,14,17) | | InChIKey | KPZYYKDXZKFBQU-UHFFFAOYSA-N | | SMILES | C1(C(N)=O)C2C(=NC3C(N=2)=CC=CC=3)C=CC=1 |
| | phenazine-1-carboxamide Usage And Synthesis |
| Uses | Oxychloroaphine (1-phenazinecarboxamide) is a simple phenazine produced by several species of Pseudomonas. Oxychloroaphine is a weakly active antifungal metabolite that plays a role in the biocontrol of plant diseases by several Pseudomonas strains. Oxychloroaphine and related phenazines are important dereplication standards in discovery research to eliminate leads due to high amounts of weakly potent actives. | | Definition | ChEBI: An aromatic amide that is phenazine substituted at C-1 with a carbamoyl group. |
| | phenazine-1-carboxamide Preparation Products And Raw materials |
|