| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | desferriferrithiocin Basic information |
| Product Name: | desferriferrithiocin | | Synonyms: | desferriferrithiocin;MJWAGSZZOQMRNY-SNVBAGLBSA-N;4-Thiazolecarboxylic acid, 4,5-dihydro-2-(3-hydroxy-2-pyridinyl)-4-methyl-, (4S)- | | CAS: | 76045-30-2 | | MF: | C10H10N2O3S | | MW: | 238.26 | | EINECS: | | | Product Categories: | | | Mol File: | 76045-30-2.mol |  |
| | desferriferrithiocin Chemical Properties |
| storage temp. | 2-8°C | | solubility | H2O: 15 mg/mL, clear | | form | powder | | color | faintly yellow to dark yellow | | Water Solubility | H2O: 15mg/mL, clear | | InChI | 1S/C10H10N2O3S/c1-10(9(14)15)5-16-8(12-10)7-6(13)3-2-4-11-7/h2-4,13H,5H2,1H3,(H,14,15)/p-1/t10-/m1/s1 | | InChIKey | MJWAGSZZOQMRNY-SNVBAGLBSA-M | | SMILES | C[C@]1(C([O-])=O)CSC(C2=C(C=CC=N2)O)=N1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | desferriferrithiocin Usage And Synthesis |
| Biochem/physiol Actions | Desferrithiocin is an iron chelator. |
| | desferriferrithiocin Preparation Products And Raw materials |
|