|
|
| | 2,2'-dihydroxy-3,3',5,5'-tetra-tert-butylbiphenyl Basic information |
| Product Name: | 2,2'-dihydroxy-3,3',5,5'-tetra-tert-butylbiphenyl | | Synonyms: | 2,2'-dihydroxy-3,3',5,5'-tetra-tert-butylbiphenyl;3,3',5,5'-tetra-tert-butylbiphenyl-2,2'-diol;3,3',5,5'-Tetra-tert-butyl-2,2'-biphenyldiol;4,4',6,6'-Tetra-tert-butyl-2,2'-bi(phenol);6,6'-Bi(2,4-di-tert-butylphenol);6,6'-Bi[2,4-di-tert-butylphenol];[1,1'-Biphenyl]-2,2'-diol, 3,3',5,5'-tetrakis(1,1-dimethylethyl)-;2,2'-Dihydroxy-3,3',5,5'-tetra-tert-butyl-1,1'-biphenyl | | CAS: | 6390-69-8 | | MF: | C28H42O2 | | MW: | 410.63 | | EINECS: | 407-920-5 | | Product Categories: | | | Mol File: | 6390-69-8.mol |  |
| | 2,2'-dihydroxy-3,3',5,5'-tetra-tert-butylbiphenyl Chemical Properties |
| Melting point | 194-195℃ | | Boiling point | 469.3±45.0 °C(Predicted) | | density | 0.981 | | vapor pressure | 0-11Pa at 25-141℃ | | storage temp. | Sealed in dry,Room Temperature | | pka | 10.76±0.48(Predicted) | | form | Powder | | color | White to Almost white | | λmax | 283nm(lit.) | | InChI | InChI=1S/C28H42O2/c1-25(2,3)17-13-19(23(29)21(15-17)27(7,8)9)20-14-18(26(4,5)6)16-22(24(20)30)28(10,11)12/h13-16,29-30H,1-12H3 | | InChIKey | GDGDLBOVIAWEAD-UHFFFAOYSA-N | | SMILES | C1(C2=CC(C(C)(C)C)=CC(C(C)(C)C)=C2O)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1O | | LogP | 10.6 | | CAS DataBase Reference | 6390-69-8 | | EPA Substance Registry System | 3,3',5,5'-Tetrakis(tert-butyl)-2,2'-biphenol (6390-69-8) |
| Risk Statements | 53 | | Safety Statements | 61 | | TSCA | TSCA listed | | HS Code | 2907.29.0500 |
| | 2,2'-dihydroxy-3,3',5,5'-tetra-tert-butylbiphenyl Usage And Synthesis |
| Uses | 3,3'',5,5''-Tetra-tert-butyl-2,2''-dihydroxybiphenyl is used in the Kolbe-Schmitt synthesis of pharmacologically useful salicylates. |
| | 2,2'-dihydroxy-3,3',5,5'-tetra-tert-butylbiphenyl Preparation Products And Raw materials |
|