|
|
| | 5ALPHA-ANDROST-16-EN-3-ONE Basic information |
| Product Name: | 5ALPHA-ANDROST-16-EN-3-ONE | | Synonyms: | 3-KETO-5ALPHA,16-ANDROSTENE;5A-ANDROST-16-EN-3-ONE;5ALPHA-ANDROST-16-EN-3-ONE;16,(5A)-ANDROSTEN-3-ONE;16-[5ALPHA]ANDROSTEN-3-ONE;OCCLESTERONE;(5alpha)-androst-16-en-3-on;androst-16-en-3-one | | CAS: | 18339-16-7 | | MF: | C19H28O | | MW: | 272.42 | | EINECS: | 242-220-1 | | Product Categories: | | | Mol File: | 18339-16-7.mol |  |
| | 5ALPHA-ANDROST-16-EN-3-ONE Chemical Properties |
| Melting point | 140-145 °C(lit.) | | Boiling point | 371.6±42.0 °C(Predicted) | | density | 1.032±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | color | White to Off-White | | biological source | synthetic (organic) | | Henry's Law Constant | 3.4×10-2 mol/(m3Pa) at 25℃, Amoore and Buttery (1978) | | InChI | InChI=1/C19H28O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h3,9,13,15-17H,4-8,10-12H2,1-2H3/t13-,15-,16-,17-,18-,19-/s3 | | InChIKey | HFVMLYAGWXSTQI-QYXZOKGRSA-N | | SMILES | [C@]12([H])CC[C@]3(C)C=CC[C@@]3([H])[C@]1([H])CC[C@@]1([H])CC(=O)CC[C@]21C |&1:0,4,9,11,15,22,r| | | LogP | 5.568 (est) | | CAS DataBase Reference | 18339-16-7(CAS DataBase Reference) |
| WGK Germany | - | | Storage Class | 11 - Combustible Solids |
| | 5ALPHA-ANDROST-16-EN-3-ONE Usage And Synthesis |
| Uses | 5α-Androst-16-en-3-one is a mammalian pheromone released as a volatile chemical cue in boar saliva to facilitate social and sexual interactions. It has been used to prime sexual behavior of sows in estrus for mating or artificial insemination. 5α-androst-16-en-3-one is also found in human sweat and urine and has been used to study receptor-mediated odorant detection and the genetic basis for anosmias. | | Uses | 5α-Androst-16-en-3-one has been used:
- to quantify its concentration in various fat tissues
- to study its trigeminal percept and implications on the rate of specific anosmia
- to study the effects of immunocastration on meat quality and sensory properties of pork bellies
| | Definition | ChEBI: 5alpha-androst-16-en-3-one is an androstanoid that is 5alpha-androst-16-ene substituted by an oxo group at position 3. It is a steroid pheromone found in high concentrations in the saliva of male pigs,. It has a role as a pheromone and a mammalian metabolite. It is a 3-oxo steroid and an androstanoid. It derives from a hydride of a 5alpha-androst-16-ene. | | General Description | 5α-Androst-16-en-3-one (androstenone) is a mammalian pheromone found in boar saliva, human sweat, and human urine. |
| | 5ALPHA-ANDROST-16-EN-3-ONE Preparation Products And Raw materials |
|