|
|
| | N-BENZOYLANTHRANILICACID Basic information |
| Product Name: | N-BENZOYLANTHRANILICACID | | Synonyms: | Dianthramide B;N-Benzoylanthanilic acid;benzoic acid, 2-(benzoylamino)-;2-BenzaMidobenzoic acid;DianthraMid B;2-(phenylcarbonylamino)benzoic acid;2-[(oxo-phenylmethyl)amino]benzoic acid;2-(Benzoylamino) | | CAS: | 579-93-1 | | MF: | C14H11NO3 | | MW: | 241.24 | | EINECS: | | | Product Categories: | | | Mol File: | 579-93-1.mol |  |
| | N-BENZOYLANTHRANILICACID Chemical Properties |
| Melting point | 178 °C | | Boiling point | 341.9±25.0 °C(Predicted) | | density | 1.334±0.06 g/cm3(Predicted) | | FEMA | 4078 | N-BENZOYLANTHRANILIC ACID | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.48±0.36(Predicted) | | Odor | fruity | | Appearance | White to off-white Solid | | Odor Type | fruity | | JECFA Number | 1552 | | Major Application | flavors and fragrances | | InChI | 1S/C14H11NO3/c16-13(10-6-2-1-3-7-10)15-12-9-5-4-8-11(12)14(17)18/h1-9H,(H,15,16)(H,17,18) | | InChIKey | WXVLIIDDWFGYCV-UHFFFAOYSA-N | | SMILES | N(c2c(cccc2)C(=O)O)C(=O)c1ccccc1 | | LogP | 3.42 |
| WGK Germany | WGK 2 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | N-BENZOYLANTHRANILICACID Usage And Synthesis |
| Chemical Properties | White solid, fruity aroma. | | Uses | flavors and fragrances | | Definition | ChEBI: An amidobenzoic acid comprising benzoic acid having a benzamido group at the 2-position. | | Aroma threshold values | Medium strength odor, fruity type. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 54, p. 3744, 1989 DOI: 10.1021/jo00276a045 |
| | N-BENZOYLANTHRANILICACID Preparation Products And Raw materials |
|