|
|
| | 3,5-Difluoronitrobenzene Basic information |
| Product Name: | 3,5-Difluoronitrobenzene | | Synonyms: | 3,5-Difluoronitrobenzene 99%;1,3-DIFLUORO-5-NITROBENZENE;3,5-DIFLUORONITROBENZENE;Benzene, 1,3-difluoro-5-nitro- (7CI,8CI,9CI);1-Nitro-3,5-difluorobenzene;3,5-Difluoro-1-nitrobenzene;5-Nitro-1,3-phenylene difluoride;3,5-Difluoronitrobenzene ,98% | | CAS: | 2265-94-3 | | MF: | C6H3F2NO2 | | MW: | 159.09 | | EINECS: | 218-867-0 | | Product Categories: | Aromatic Halides (substituted);Miscellaneous;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks;HALIDE;Halides | | Mol File: | 2265-94-3.mol |  |
| | 3,5-Difluoronitrobenzene Chemical Properties |
| Melting point | 17 °C (lit.) | | Boiling point | 176-177 °C (lit.) | | density | 1.407 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.499(lit.) | | RTECS | CZ5712000 | | Fp | 165 °F | | storage temp. | 2-8°C | | form | clear liquid | | color | Light yellow to Yellow to Orange | | Specific Gravity | 1.407 | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. | | InChI | 1S/C6H3F2NO2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H | | InChIKey | AUQBBDWDLJSKMI-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(F)cc(F)c1 | | CAS DataBase Reference | 2265-94-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3265 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | HS Code | 29049090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,5-Difluoronitrobenzene Usage And Synthesis |
| Chemical Properties | Clear yellow liquid | | Uses | 3,5-Difluoronitrobenzene has been used to improve thermal stability of immobilized porcine pancrease lipase. | | General Description | Molecular structure of 3,5-difluoronitrobenzene was studied by gas-phase electron diffraction, MP2 ab initio and by B3LYP density functional calculations. |
| | 3,5-Difluoronitrobenzene Preparation Products And Raw materials |
|