1,3-Diacetoxy-2-bromo-2-nitropropane manufacturers
|
| | 1,3-Diacetoxy-2-bromo-2-nitropropane Basic information | | Uses |
| | 1,3-Diacetoxy-2-bromo-2-nitropropane Chemical Properties |
| Boiling point | 317.6±37.0 °C(Predicted) | | density | 1.604±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C7H10BrNO6/c1-5(10)14-3-7(8,9(12)13)4-15-6(2)11/h3-4H2,1-2H3 | | InChIKey | GALJOEMOAKHCBH-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)C(Br)([N+]([O-])=O)COC(=O)C |
| | 1,3-Diacetoxy-2-bromo-2-nitropropane Usage And Synthesis |
| Uses | 1,3-Diacetyl-2-bromo-2-nitropropane is a bactericide, mainly used in industrial circulating water, paper pulp, coatings, plastics, cosmetics, wood, cooling water circulation systems, and for industrial applications such as sterilization, mildew prevention, corrosion prevention, and algae control. | | Chemical Properties | 1,3-Diacetoxy-2-bromo-2-nitropropane is liquid and soluble in organic solvents and water. |
| | 1,3-Diacetoxy-2-bromo-2-nitropropane Preparation Products And Raw materials |
|