- Nepodin
-
- $52.00 / 1mg
-
2026-02-28
- CAS:3785-24-8
- Min. Order:
- Purity: 98.50%
- Supply Ability: 10g
- Musizin
-
- $0.00 / 1kg
-
2025-06-13
- CAS:3785-24-8
- Min. Order: 1kg
- Purity: 10%
- Supply Ability: 1000 kg
|
| | 1-(1,8-dihydroxy-3-methyl-naphthalen-2-yl)ethanone Basic information |
| | 1-(1,8-dihydroxy-3-methyl-naphthalen-2-yl)ethanone Chemical Properties |
| Melting point | 165-166℃ (methanol ) | | Boiling point | 357.9±22.0 °C(Predicted) | | density | 1.285±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 4°C, protect from light | | solubility | Methanol: soluble | | form | A solid | | pka | 5.13±0.50(Predicted) | | color | White to yellow | | InChI | InChI=1S/C13H12O3/c1-7-6-9-4-3-5-10(15)12(9)13(16)11(7)8(2)14/h3-6,15-16H,1-2H3 | | InChIKey | DMLHPCALHMPJHS-UHFFFAOYSA-N | | SMILES | C(=O)(C1=C(C)C=C2C(=C1O)C(O)=CC=C2)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-(1,8-dihydroxy-3-methyl-naphthalen-2-yl)ethanone Usage And Synthesis |
| Chemical Properties | Pale yellow crystals, soluble in methanol, ethanol, ethyl acetate, insoluble in water, derived from the root of the Polygonaceae plant Rhizoma Cibotii or Rhizoma Nepalensis. | | Uses | 1-(1,8-Dihydroxy-3-methyl-naphthalen-2-yl)-ethanone is a naphthalene for proteomics research. | | Definition | ChEBI: Nepodin is a member of naphthols. | | in vivo | Nepodin (Musizin) (orally administration; 2-10 mg/kg; 4 weeks) improves the impaired glucose tolerance of db/db mice, also decreases an increase in plasma insulin concentration of db/db mice in a dose-dependent manner[2]. | Animal Model: | C57BL/KsJ-db/db mice[2] | | Dosage: | 2 mg/kg; 10 mg/kg | | Administration: | Orally administration; 2-10 mg/kg; 4 weeks | | Result: | Had antihyperglycemic potential and improved insulin resistance. |
| | IC 50 | Plasmodium |
| | 1-(1,8-dihydroxy-3-methyl-naphthalen-2-yl)ethanone Preparation Products And Raw materials |
|