| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:2,4-Dihydroxy-6-methoxy-3-methylacetophenone
CAS:83459-37-4
Purity:>97.0% Package:5mg Remarks:BBP04117
|
|
| | 2,4－Dihydroxy－6－methoxy－3－methylacetophenone Basic information |
| | 2,4－Dihydroxy－6－methoxy－3－methylacetophenone Chemical Properties |
| Melting point | 224℃ | | Boiling point | 355.5±22.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | pka | 7.95±0.28(Predicted) | | InChI | InChI=1S/C10H12O4/c1-5-7(12)4-8(14-3)9(6(2)11)10(5)13/h4,12-13H,1-3H3 | | InChIKey | RFKMWWMZUHXFBA-UHFFFAOYSA-N | | SMILES | C(=O)(C1=C(OC)C=C(O)C(C)=C1O)C |
| | 2,4－Dihydroxy－6－methoxy－3－methylacetophenone Usage And Synthesis |
| Uses | Ebracteolata cpd B is a natural phenol compound found in Euphorbia ebracteolata[1]. | | Preparation | Preparation by reduction of 3-formyl-2,4-dihydroxy- 6-methoxyacetophenone with hydrochloric acid and amalgamated zinc in gently heated aqueous methanol (64%). | | References | [1] Zhuang G, et al. Study on HPLC chromatograms of different processed Euphorbia ebracteolata products and content change of three chemical components. Zhongguo Zhong Yao Za Zhi. 2013 May;38(10):1526-30. Chinese. PMID:23947130 |
| | 2,4－Dihydroxy－6－methoxy－3－methylacetophenone Preparation Products And Raw materials |
|