Curzerenone manufacturers
- Curzerenone
-
- $9.80 / 1KG
-
2020-02-11
- CAS:20493-56-5
- Min. Order: 1g
- Purity: >98%
- Supply Ability: 20 tons
|
| | Curzerenone Basic information |
| Product Name: | Curzerenone | | Synonyms: | Curzerenone;6,7-Dihydro-5beta-isopropenyl-3,6beta-dimethyl-6-vinyl-4(5H)-benzofuranone;rel-(5R,6R)-3,6-Dimethyl-5-(prop-1-en-2-yl)-6-vinyl-6,7-dihydrobenzofuran-4(5H)-one | | CAS: | 20493-56-5 | | MF: | C15H18O2 | | MW: | 230.3 | | EINECS: | | | Product Categories: | | | Mol File: | 20493-56-5.mol |  |
| | Curzerenone Chemical Properties |
| Boiling point | 320.6±42.0 °C(Predicted) | | density | 1.063±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in chloroform | | form | liquid | | color | Colorless-yellowish oily | | InChI | 1S/C15H18O2/c1-6-15(5)7-11-12(10(4)8-17-11)14(16)13(15)9(2)3/h6,8,13H,1-2,7H2,3-5H3/t13-,15-/m0/s1 | | InChIKey | ZVMJXSJCBLRAPD-ZFWWWQNUSA-N | | SMILES | [o]1c2c(c(c1)C)C(=O)[C@@H]([C@@](C2)(C)C=C)C(=C)C | | LogP | 0.315 (est) |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | Curzerenone Usage And Synthesis |
| Uses | Curzerenone is one of constituents of leaf essential oil extracted from L. pulcherrima. Shows slight inhibitory effective against E. coli[1]. | | Definition | ChEBI: Curzerenone is a monoterpenoid. | | References | [1] Subhash C, et al. Antioxidant and antibacterial activities of the leaf essential oil and its constituents furanodienone and curzerenone from Lindera pulcherrima (Nees.) Benth. ex hook. f. Pharmacognosy Res. 2012 Apr;4(2):80-4. DOI:10.4103/0974-8490.94721 |
| | Curzerenone Preparation Products And Raw materials |
|