|
|
| | 2-BROMO-5-(TRIFLUOROMETHOXY)ANILINE Basic information | | Uses |
| Product Name: | 2-BROMO-5-(TRIFLUOROMETHOXY)ANILINE | | Synonyms: | 2-Amino-1-bromo-4-(trifluoromethoxy)benzene;3-Amino-4-bromo-alpha,alpha,alpha-trifluoroanisole;4-Bromo-3-aminotrifluoromethoxybenzene;3-Amino-4-bromo-α,α,α-trifluoroanisole;2-Amino-1-bromo-4-(trifluoromethoxy)benzene
3-Amino-4-bromo-alpha,alpha,alpha-trifluoroanisole;Benzenamine, 2-bromo-5-(trifluoromethoxy)-;3-AMino-4-broMoanisole[2-BroMo-5-Methoxyaniline];2-Bromo-5-(trifluoromethoxy)aniline > | | CAS: | 887267-47-2 | | MF: | C7H5BrF3NO | | MW: | 256.02 | | EINECS: | | | Product Categories: | Fluorine series | | Mol File: | 887267-47-2.mol |  |
| | 2-BROMO-5-(TRIFLUOROMETHOXY)ANILINE Chemical Properties |
| Boiling point | 234.7±35.0 °C(Predicted) | | density | 1.71 | | refractive index | 1.5040-1.5080 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | clear liquid | | pka | 1.30±0.10(Predicted) | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C7H5BrF3NO/c8-5-2-1-4(3-6(5)12)13-7(9,10)11/h1-3H,12H2 | | InChIKey | MMRYEBVMIOYMIF-UHFFFAOYSA-N | | SMILES | C1(N)=CC(OC(F)(F)F)=CC=C1Br | | CAS DataBase Reference | 887267-47-2 |
| | 2-BROMO-5-(TRIFLUOROMETHOXY)ANILINE Usage And Synthesis |
| Uses | 2-Bromo-5-trifluoromethoxyaniline is an amine organic compound, and some literature reports its use in the preparation of Nav1.8 inhibitors. |
| | 2-BROMO-5-(TRIFLUOROMETHOXY)ANILINE Preparation Products And Raw materials |
|