|
|
| | 2-Amino-3,6,8-naphthalenetrisulfonic acid Basic information |
| Product Name: | 2-Amino-3,6,8-naphthalenetrisulfonic acid | | Synonyms: | 2-Amino-3,6,8-naphthalenetrisulfonic acid;K-ACID;7-aminonaphthalene-1,3,6-trisulfonic acid;kyselinakochova;AMINO K ACID;2-NAPHTHYLAMINE-3,6,8-TRISULFONIC ACID;7-Aminonaphthalene-1,3,6-trisulphonic acid;7-AMINO-1,3,6-NAPHTHALENETRISULFONIC ACID | | CAS: | 118-03-6 | | MF: | C10H9NO9S3 | | MW: | 383.37 | | EINECS: | 204-229-9 | | Product Categories: | Intermediates of Dyes and Pigments;Organic acids | | Mol File: | 118-03-6.mol |  |
| | 2-Amino-3,6,8-naphthalenetrisulfonic acid Chemical Properties |
| Boiling point | 702.53℃[at 101 325 Pa] | | density | 1.7995 (rough estimate) | | refractive index | 1.6800 (estimate) | | storage temp. | 2-8°C | | pka | -1.27±0.40(Predicted) | | Water Solubility | 1000g/L at 25℃ | | InChI | InChI=1S/C10H9NO9S3/c11-8-4-7-5(2-10(8)23(18,19)20)1-6(21(12,13)14)3-9(7)22(15,16)17/h1-4H,11H2,(H,12,13,14)(H,15,16,17)(H,18,19,20) | | InChIKey | GFPQSWFFPRQEHH-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=C2C(C=C(S(O)(=O)=O)C(N)=C2)=CC(S(O)(=O)=O)=C1 | | LogP | -11.96 | | CAS DataBase Reference | 118-03-6(CAS DataBase Reference) | | EPA Substance Registry System | 1,3,6-Naphthalenetrisulfonic acid, 7-amino- (118-03-6) |
| TSCA | TSCA listed | | Toxicity | rat,LD50,oral,13gm/kg (13000mg/kg),"Prehled Prumyslove Toxikologie; Organicke Latky," Marhold, J., Prague, Czechoslovakia, Avicenum, 1986Vol. -, Pg. 1058, 1986. |
| | 2-Amino-3,6,8-naphthalenetrisulfonic acid Usage And Synthesis |
| Chemical Properties | 2-Aminonaphthalene-3,6,8-trisulfonic acid [118-03-6]. (7-aminonaphthalene-1,3,6- trisulfonic acid), C10H9NO9S3, Mr 383.36, and its disodium salts are soluble in water, but the dipotassium salt is much less soluble. Reduction with zinc dust and alkali results in 2-aminonaphthalene-3,6-disulfonic acid, and caustic fusion at 240℃ gives 2-amino-8-hydroxynaphthalene-3,6-disulfonic acid. | | Production Methods | 2-Aminonaphthalene-6,8-disulfonic acid is sulfonated with 65 % oleum at 125℃ for 12 h in the presence of anhydrous sodium sulfate. After quenching and liming out, the hot solution of calcium salt is basified with sodium carbonate and the resulting solution of the trisodium salt is used directly for caustic fusion to give 2-amino-8-hydroxynaphthalene-3,6-disulfonic acid. | | Flammability and Explosibility | Not classified | | References | [1] Patent: CN106866467, 2017, A. Location in patent: Paragraph 0025; 0029; 0033; 0037 |
| | 2-Amino-3,6,8-naphthalenetrisulfonic acid Preparation Products And Raw materials |
|