|
|
| | Methyl 2,4-dibromobutyrate Basic information |
| Product Name: | Methyl 2,4-dibromobutyrate | | Synonyms: | BUTANOIC ACID, 2,4-DIBROMO-METHYL ESTER;METHYL 2,4-DIBROMOBUTYRATE;2,4-DibroMo Methyl butyrate;Methyl 2,4-dibromobutyrate >=97.0% (GC);2,4-dibromobutanoic acid methyl ester;Methyl 2,4-dibromobutyrate ISO 9001:2015 REACH;METHYL 2,4-DIBROMOBUTANOATE | | CAS: | 70288-65-2 | | MF: | C5H8Br2O2 | | MW: | 259.92 | | EINECS: | | | Product Categories: | C2 to C5;Carbonyl Compounds;Esters | | Mol File: | 70288-65-2.mol |  |
| | Methyl 2,4-dibromobutyrate Chemical Properties |
| density | 1.840 g/mL at 20 °C (lit.) | | storage temp. | 2-8°C | | form | solid | | BRN | 1757129 | | InChI | InChI=1S/C5H8Br2O2/c1-9-5(8)4(7)2-3-6/h4H,2-3H2,1H3 | | InChIKey | DQHIGEQXJBMKKY-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(Br)CCBr | | CAS DataBase Reference | 70288-65-2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3334 | | WGK Germany | 3 | | F | 19 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Methyl 2,4-dibromobutyrate Usage And Synthesis |
| Uses | Methyl 2,4-dibromobutyrate was used in the preparation of stereoisomers of azetidine-2-carboxylic amide derivative. | | General Description | Methyl 2,4-dibromobutyrate reacts with sodium azide in dimethylformamide to yield 2-azido-4-bromobutyrate. |
| | Methyl 2,4-dibromobutyrate Preparation Products And Raw materials |
|