|
|
| | 3,4-Dihydro-7-methoxy-4-oxoquinazolin-6-yl acetate Basic information |
| Product Name: | 3,4-Dihydro-7-methoxy-4-oxoquinazolin-6-yl acetate | | Synonyms: | 7-Methoxy-4-oxo-1,4-dihydroquinazolin-6-yl acetate;6-Acetoxy-7-methoxy-3H-quinazolin-4-one;4-hydroxy-7-methoxyquinazolin-6-yl acetate;6-methoxy-4-oxo-3,4-dihydroquinazolin-7-yl acetate;(7-methoxy-4-oxo-1H-quinazolin-6-yl) acetate;6-Acetoxy-7-methoxy-3H-quinazolin-4-one;6-acetoxy-7-methoxy-3,4-dihydroquinazolin-4(3H)-one;4-Dihydro-7-methoxy-4-oxoquinazolin-6-yl acetate | | CAS: | 179688-53-0 | | MF: | C11H10N2O4 | | MW: | 234.21 | | EINECS: | 808-050-2 | | Product Categories: | | | Mol File: | 179688-53-0.mol |  |
| | 3,4-Dihydro-7-methoxy-4-oxoquinazolin-6-yl acetate Chemical Properties |
| Melting point | 293 °C | | Boiling point | 390.5±52.0 °C(Predicted) | | density | 1.39 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly, Heated), Methanol (Slightly) | | form | powder to crystal | | pka | 0.67±0.20(Predicted) | | color | White to Yellow | | InChI | InChI=1S/C11H10N2O4/c1-6(14)17-10-3-7-8(4-9(10)16-2)12-5-13-11(7)15/h3-5H,1-2H3,(H,12,13,15) | | InChIKey | SOLQIFINSOHAQD-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(OC(C)=O)C(OC)=C2)C(=O)NC=1 | | CAS DataBase Reference | 179688-53-0 |
| | 3,4-Dihydro-7-methoxy-4-oxoquinazolin-6-yl acetate Usage And Synthesis |
| Chemical Properties | Brown solid powder | | Uses | 4-Hydroxy-7-methoxyquinazolin-6-yl Ester Acetic Acid exhibit potent inhibitory activity against VEGFR-2/HDAC and a human breast cancer cell line MCF-7. | | Synthesis | 6-Hydroxy-7-methoxyquinazolin-4-one (1.92 g, 10 mmol) was placed in acetic anhydride (20 mL) and pyridine (4 mL) was added slowly with stirring. The reaction mixture was heated to 100 °C and kept for 4 hours. After the reaction was completed, it was cooled to room temperature and ice water was added to quench the reaction. The white solid that precipitated was the intermediate 7-methoxy-4-oxo-3,4-dihydroquinazolin-6-ol acetate (M-1, 2.32 g, 99% yield). | | References | [1] Patent: CN106632089, 2017, A. Location in patent: Paragraph 0077; 0078; 0079
[2] Patent: CN106045980, 2016, A. Location in patent: Paragraph 0018; 0019; 0020
[3] Patent: EP1785420, 2007, A1. Location in patent: Page/Page column 18
[4] Patent: US2007/149523, 2007, A1. Location in patent: Page/Page column 13
[5] Patent: WO2005/97134, 2005, A2. Location in patent: Page/Page column 13; figure 1 |
| | 3,4-Dihydro-7-methoxy-4-oxoquinazolin-6-yl acetate Preparation Products And Raw materials |
|