| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
3,3-Dimethylpiperidin-4-ol manufacturers
|
| | 3,3-Dimethylpiperidin-4-ol Basic information |
| | 3,3-Dimethylpiperidin-4-ol Chemical Properties |
| Boiling point | 195.2±15.0 °C(Predicted) | | density | 0.936±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 14.98±0.40(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C7H15NO/c1-7(2)5-8-4-3-6(7)9/h6,8-9H,3-5H2,1-2H3 | | InChIKey | ZCCBPOMEIUZJMR-UHFFFAOYSA-N | | SMILES | N1CCC(O)C(C)(C)C1 |
| | 3,3-Dimethylpiperidin-4-ol Usage And Synthesis |
| | 3,3-Dimethylpiperidin-4-ol Preparation Products And Raw materials |
|