- Xanthine sodium salt
-
- $100.00
-
2025-06-20
- CAS:1196-43-6
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 20tons
|
| | Xanthine sodium salt Basic information |
| Product Name: | Xanthine sodium salt | | Synonyms: | XANTHINE SODIUM SALT;2,6-DIHYDROXYPURINE SODIUM SALT;XANTHINE SODIUM CELL CULTURE TESTED;XANTHINE SODIUM SALT CRYSTALLINE 98-100%;crystalline98-100%;1H-Purine-2,6-dione, 3,7-dihydro-, monosodium salt;XANTHINE MONOSODIUM SALT;Xanthine SodiuM Anhydrous | | CAS: | 1196-43-6 | | MF: | C5H5N4NaO2 | | MW: | 176.11 | | EINECS: | | | Product Categories: | | | Mol File: | 1196-43-6.mol |  |
| | Xanthine sodium salt Chemical Properties |
| solubility | dilute NaOH: clear to hazy | | form | Crystalline Powder | | biological source | synthetic (organic) | | InChI | InChI=1S/C5H4N4O2.Na.H/c10-4-2-3(7-1-6-2)8-5(11)9-4;;/h1H,(H3,6,7,8,9,10,11);; | | InChIKey | JAZQMXVZANZJSO-UHFFFAOYSA-N | | SMILES | O=C1NC(=O)NC2NC=NC1=2.[NaH] |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-68/20/21/22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | STOT SE 2 |
| | Xanthine sodium salt Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Xanthine sodium salt has been used:
- as a component in superoxide dismutase (SOD)-inhibitable ferricytochrome c reduction assay
- as a component in selection of chimeric Modified Vaccinia virus Ankara (MVA)
- as a substrate in the reaction mixture for xanthine oxidase assay
| | General Description | Xanthine is commonly present in tea, coffee and cocoa. Xanthine is a nitrogenous compound present in blood and urine. | | Biochem/physiol Actions | Xanthine possesses therapeutic properties. It acts as a mild stimulant of the central nervous system. |
| | Xanthine sodium salt Preparation Products And Raw materials |
|