|
|
| | 4-methoxy-3,5-dimethylbenzenesulfonyl chloride Basic information |
| | 4-methoxy-3,5-dimethylbenzenesulfonyl chloride Chemical Properties |
| form | solid | | InChI | 1S/C9H11ClO3S/c1-6-4-8(14(10,11)12)5-7(2)9(6)13-3/h4-5H,1-3H3 | | InChIKey | VEGVNPNJUIRSMO-UHFFFAOYSA-N | | SMILES | ClS(=O)(C1=CC(C)=C(OC)C(C)=C1)=O |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-methoxy-3,5-dimethylbenzenesulfonyl chloride Usage And Synthesis |
| | 4-methoxy-3,5-dimethylbenzenesulfonyl chloride Preparation Products And Raw materials |
|