|
|
| | OTAVA-BB BB7015170010 Basic information |
| Product Name: | OTAVA-BB BB7015170010 | | Synonyms: | TIMTEC-BB SBB011775;OTAVA-BB BB7015170010;3-Ethyl-5-methyl-4-oxo-3,4-dihydro-thieno[2,3-d]-pyrimidine-6-carboxylic acid;3-ethyl-5-methyl-4-oxo-3H,4H-thieno[2,3-d]pyrimidine-6-carboxylic acid;Thieno[2,3-d]pyrimidine-6-carboxylic acid, 3-ethyl-3,4-dihydro-5-methyl-4-oxo-;3-Ethyl-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxylic acid | | CAS: | 441718-51-0 | | MF: | C10H10N2O3S | | MW: | 238.26 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | OTAVA-BB BB7015170010 Chemical Properties |
| Boiling point | 485.0±55.0 °C(Predicted) | | density | 1.52±0.1 g/cm3(Predicted) | | form | solid | | pka | 3.69±0.20(Predicted) | | InChI | 1S/C10H10N2O3S/c1-3-12-4-11-8-6(9(12)13)5(2)7(16-8)10(14)15/h4H,3H2,1-2H3,(H,14,15) | | InChIKey | SXQISXMEDDDZKV-UHFFFAOYSA-N | | SMILES | O=C1C2=C(N=CN1CC)SC(C(O)=O)=C2C |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | OTAVA-BB BB7015170010 Usage And Synthesis |
| Definition | ChEBI: 3-ethyl-5-methyl-4-oxo-6-thieno[2,3-d]pyrimidinecarboxylic acid is an organonitrogen heterocyclic compound, an organic heterobicyclic compound and an organosulfur heterocyclic compound. |
| | OTAVA-BB BB7015170010 Preparation Products And Raw materials |
|