|
|
| | (-)-DIHYDROCARVYL ACETATE Basic information |
| | (-)-DIHYDROCARVYL ACETATE Chemical Properties |
| Boiling point | 232-234 °C(lit.) | | density | 0.947 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.459(lit.) | | FEMA | 2380 | DIHYDROCARVYL ACETATE | | Fp | 194 °F | | Odor | at 100.00 %. floral rose cuminseed sweet minty | | Odor Type | floral | | Optical Rotation | [α]/D ≤55°, neat | | biological source | synthetic | | JECFA Number | 379 | | BRN | 2443836 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1/C12H20O2/c1-8(2)11-6-5-9(3)12(7-11)14-10(4)13/h9,11-12H,1,5-7H2,2-4H3/t9-,11-,12-/s3 | | InChIKey | TUSIZTVSUSBSQI-PNOABSEDNA-N | | SMILES | [C@@H]1(OC(=O)C)C[C@H](C(C)=C)CC[C@H]1C |&1:0,6,12,r| | | LogP | 3.86 | | CAS DataBase Reference | 20777-49-5 | | EPA Substance Registry System | Cyclohexanol, 2-methyl-5-(1-methylethenyl)-, acetate, (1R,2R,5R)-rel- (20777-49-5) |
| Safety Statements | 23-24/25 | | WGK Germany | 2 | | RTECS | OT0210000 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | (-)-DIHYDROCARVYL ACETATE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Chemical Properties | Dihydrocarvyl acetate has a sweet, floral, rose-like odor and slightly minty flavor. It is used as an imitation spearmint. | | Occurrence | Reported found in celery, Scotch spearmint and oils of Mentha spp. | | Uses | flavors and fragrances | | Preparation | Acetylation of dihydrocarveol. | | Definition | ChEBI: Dihydrocarveol acetate is a p-menthane monoterpenoid. | | Taste threshold values | Taste characteristics at 25 ppm: floral, vegetative and minty with cooking, rose and bean nuances. | | Safety Profile | A skin irritant. When
heated to decomposition it emits acrid
smoke and irritating fumes. |
| | (-)-DIHYDROCARVYL ACETATE Preparation Products And Raw materials |
|