|
|
| | methyl 3-amino-2-fluorobenzoate Basic information |
| Product Name: | methyl 3-amino-2-fluorobenzoate | | Synonyms: | methyl 3-amino-2-fluorobenzoate;2-Fluoro-3-(methoxycarbonyl)aniline;3-amino-2-fluoroBenzoic acid Methyl ester;Methyl 2-fluoro-3-aminobenzoate;CL029;Benzoic acid, 3-amino-2-fluoro-, methyl ester;methyl 3-amino-2-fluorobenzoate ISO 9001：2015 REACH;3-?amino-?2-?fluoro-?, methyl ester Benzoic acid | | CAS: | 1195768-18-3 | | MF: | C8H8FNO2 | | MW: | 169.15 | | EINECS: | 629-868-4 | | Product Categories: | | | Mol File: | 1195768-18-3.mol |  |
| | methyl 3-amino-2-fluorobenzoate Chemical Properties |
| Boiling point | 282.6±25.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | refractive index | 1.5570 to 1.5610 | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | clear liquid | | pka | 2.06±0.10(Predicted) | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C8H8FNO2/c1-12-8(11)5-3-2-4-6(10)7(5)9/h2-4H,10H2,1H3 | | InChIKey | UOYDNSRSUSNCKS-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=CC(N)=C1F | | CAS DataBase Reference | 1195768-18-3 |
| | methyl 3-amino-2-fluorobenzoate Usage And Synthesis |
| Chemical Properties | white solid. | | Uses | Methyl 3-amino-2-fluorobenzoate is an important compound during the synthesis of Dabrafenib. Dabrafenib is a type of kinase inhibitor that is commonly prescribed to individuals suffering from certain forms of melanoma, non-small cell lung cancer, and thyroid cancer. |
| | methyl 3-amino-2-fluorobenzoate Preparation Products And Raw materials |
|