|
|
| | 3-Amino-5-bromobenzotrifluoride Basic information |
| | 3-Amino-5-bromobenzotrifluoride Chemical Properties |
| Boiling point | 220-223 °C (lit.) | | density | 1.697 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.528(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 2.30±0.10(Predicted) | | form | Liquid | | color | Colorless to yellow | | InChI | InChI=1S/C7H5BrF3N/c8-5-1-4(7(9,10)11)2-6(12)3-5/h1-3H,12H2 | | InChIKey | HJTLKVYOWNTDPF-UHFFFAOYSA-N | | SMILES | C1(N)=CC(C(F)(F)F)=CC(Br)=C1 | | CAS DataBase Reference | 54962-75-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | HS Code | 29214300 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Amino-5-bromobenzotrifluoride Usage And Synthesis |
| Description | 3-Amino-5-bromobenzotrifluoride is an organic synthetic reagent or pharmaceutical intermediate component used in the synthesis of other organic compounds such as 3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)aniline, fluorinated 2-benzylphthalazine-1 (2H)-one, 1-phthalazinamine and 1-alkoxy/benzyloxyphthalazine derivatives. It can also be used to prepare the targeted anti-cancer drug Nilotinib, which can be used to treat chronic granulocytic leukaemia (CML). | | Chemical Properties | White solid | | Uses | 3-Amino-5-bromobenzotrifluoride may be used in the synthesis of 3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)aniline. | | Hazard |
3-Amino-5-bromobenzotrifluoride has acute toxicity (oral, inhalation,dermal), it causes skin irritation and eye irritation.
| | Synthesis |
3-Amino-5-bromotrifluorotoluene was prepared from 4-bromo-2-trifluorotoluene by acetylation, nitration, deacetylation, deamination, and reduction.
|
| | 3-Amino-5-bromobenzotrifluoride Preparation Products And Raw materials |
|